Products 38444-78-9
CAS 38444-78-9 appears in our catalog under these names: 2,2',3-Trichlorobiphenyl, PCB 16, ROTI®Star, 10 mg, glass, PCB 16, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Biosynth, Roth, HPC Standards. Available pack sizes: 25mg, 10mg, 50mg, 1x5ml.
1,2-dichloro-3-(2-chlorophenyl)benzene (CAS 38444-78-9) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 1,2-dichloro-3-(2-chlorophenyl)benzene. InChIKey: XVIZMMSINIOIQP-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 1,2-dichloro-3-(2-chlorophenyl)benzene |
| InChIKey | XVIZMMSINIOIQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=CC=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)