Products 38444-84-7
CAS 38444-84-7 appears in our catalog under these names: PCB No. 20, PCB No. 20 10 µg/mL in Isooctane, 47059, 2,3,3'-Trichlorobiphenyl (IUPAC N, PCB 20, ROTI®Star, 10 mg, glass, PCB 20, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Dr. Ehrenstorfer, Sigma-Aldrich, Roth, HPC Standards. Available pack sizes: 10mg, 10ml, 25MG, 1x5ml.
1,2-dichloro-3-(3-chlorophenyl)benzene (CAS 38444-84-7) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 1,2-dichloro-3-(3-chlorophenyl)benzene. InChIKey: SXHLTVKPNQVZGL-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 1,2-dichloro-3-(3-chlorophenyl)benzene |
| InChIKey | SXHLTVKPNQVZGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)