CAS 1032508-03-4 appears in our catalog under these names: 1-(4-Chlorostyryl)-3,5-dimethoxybenzene, PDM11/ 99.77% (existing batch purity), PDM 11, PDM 11, PDM11, 99.93%. Offered by: Chemat, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 50mg, 10mg, 1mg, 100mg, 200mg, 250mg.
1-[(E)-2-(4-chlorophenyl)ethenyl]-3,5-dimethoxybenzene (CAS 1032508-03-4) is a chemical compound with the molecular formula C16H15ClO2 and a molecular weight of 274.74 g/mol. IUPAC name: 1-[(E)-2-(4-chlorophenyl)ethenyl]-3,5-dimethoxybenzene. InChIKey: VPHHOTWBLKKBBT-ONEGZZNKSA-N.
| Molecular formula | C16H15ClO2 |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3,5-dimethoxybenzene |
| InChIKey | VPHHOTWBLKKBBT-ONEGZZNKSA-N |
| SMILES | COC1=CC(=CC(=C1)/C=C/C2=CC=C(C=C2)Cl)OC |
Computed by PubChem (NCBI)