cas: 122-05-4 — see every product listed under this CAS number, including other names
PYRAZINE-2,5-DICARBOXYLIC ACID, 97% (CAS 122-05-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146JN-25g |
| cas | 122-05-4 |
| size | 25g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 174.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Pyrazine-2,5-dicarboxylic acid (CAS 122-05-4) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,5-dicarboxylic acid. InChIKey: GMIOYJQLNFNGPR-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,5-dicarboxylic acid |
| InChIKey | GMIOYJQLNFNGPR-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)