CAS 133432-71-0 appears in our catalog under these names: Peldesine, Peldesine/ 99.95% (existing batch purity), Peldesine, 98.06%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CAS 133432-71-0) is a chemical compound with the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. IUPAC name: 2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one. InChIKey: DOHVAKFYAHLCJP-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | DOHVAKFYAHLCJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC2=CNC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)