Propargyl P-Toluenesulfonate, 95%, 95%
cas: 6165-76-0 — see every product listed under this CAS number, including other names
Propargyl P-Toluenesulfonate, 95%, 95% (CAS 6165-76-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 15g, 25g, 100g, 10g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TZ3-1g |
| cas | 6165-76-0 |
| size | 1g |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 15g | 218.00 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 856.40 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 50g | 506.00 Pln | |
| Chemat | 75g | 717.20 Pln | |
| Chemat | 200g | 1571.60 Pln | |
| Chemat | 300g | 2306.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Prop-2-ynyl 4-methylbenzenesulfonate (CAS 6165-76-0) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: prop-2-ynyl 4-methylbenzenesulfonate. InChIKey: LMBVCSFXFFROTA-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | prop-2-ynyl 4-methylbenzenesulfonate |
| InChIKey | LMBVCSFXFFROTA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC#C |
Computed by PubChem (NCBI)
Synonyms:
Propargyl p-toluenesulfonate, p-TOLUENESULFONIC ACID, 2-PROPYNYL ESTER, 2-Propyn-1-ol, 4-methylbenzenesulfonate, 2-propynyl p-toluenesulfonate, 4-11-00-00263 (Beilstein Handbook Reference), Propargyl Tosylate, Prop-2-yn-1-yl 4-methylbenzenesulfonate, prop-2-ynyl 4-methylbenzenesulfonate, Propargyl p-toluene sulfonate, prop-2-yn-1-yl 4-methylbenzene-1-sulfonate