Products 336186-19-7

CAS 336186-19-7 is the registry number for 2-[(2-Oxopropyl)sulfanyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-oxopropylsulfanyl)benzoic acid (CAS 336186-19-7) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 2-(2-oxopropylsulfanyl)benzoic acid. InChIKey: QIFGESFKZRVPBT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O3S
Molecular weight210.25 g/mol
IUPAC name2-(2-oxopropylsulfanyl)benzoic acid
InChIKeyQIFGESFKZRVPBT-UHFFFAOYSA-N
SMILESCC(=O)CSC1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)