CAS 886505-51-7 appears in our catalog under these names: 5-(3-Hydroxy-3-methylbut-1-yn-1-yl)thiophene-2-carboxylic acid, 95%, 5-(3-Hydroxy-3-methylbut-1-yn-1-yl)thiophene-2-carboxylic acid 95+%, 5-(3-Hydroxy-3-methylbut-1-yn-1-yl)thiophene-2-carboxylic acid, 95+%, 95+%, 5-(3-Hydroxy-3-methyl-but-1-ynyl)-thiophene-2-carboxylic acid, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-(3-hydroxy-3-methylbut-1-ynyl)thiophene-2-carboxylic acid (CAS 886505-51-7) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 5-(3-hydroxy-3-methylbut-1-ynyl)thiophene-2-carboxylic acid. InChIKey: KQYYVOWGEQQGGW-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | 5-(3-hydroxy-3-methylbut-1-ynyl)thiophene-2-carboxylic acid |
| InChIKey | KQYYVOWGEQQGGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C#CC1=CC=C(S1)C(=O)O)O |
Computed by PubChem (NCBI)