CAS 22536-46-5 appears in our catalog under these names: 2-[(2-Oxo-2-phenylethyl)sulfanyl]acetic acid, 95%, ((2-Oxo-2-phenylethyl)sulfanyl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g.
2-phenacylsulfanylacetic acid (CAS 22536-46-5) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 2-phenacylsulfanylacetic acid. InChIKey: NNNVHZPLMZHPBQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | 2-phenacylsulfanylacetic acid |
| InChIKey | NNNVHZPLMZHPBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CSCC(=O)O |
Computed by PubChem (NCBI)