CAS 1252672-30-2 is the registry number for 3-Formyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (CAS 1252672-30-2) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 3-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid. InChIKey: GJCOXDAVBZRLDY-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | 3-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid |
| InChIKey | GJCOXDAVBZRLDY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)C(=O)O)C=O |
Computed by PubChem (NCBI)