Products 1252672-30-2

CAS 1252672-30-2 is the registry number for 3-Formyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (CAS 1252672-30-2) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 3-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid. InChIKey: GJCOXDAVBZRLDY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O3S
Molecular weight210.25 g/mol
IUPAC name3-formyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid
InChIKeyGJCOXDAVBZRLDY-UHFFFAOYSA-N
SMILESC1CCC2=C(C1)C(=C(S2)C(=O)O)C=O

Computed by PubChem (NCBI)