CAS 95735-64-1 is the registry number for 5,6-Dimethoxybenzo[b]thiophen-3(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethoxy-1-benzothiophen-3-one (CAS 95735-64-1) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 5,6-dimethoxy-1-benzothiophen-3-one. InChIKey: MEDPGNDUIOQOLP-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | 5,6-dimethoxy-1-benzothiophen-3-one |
| InChIKey | MEDPGNDUIOQOLP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)CS2)OC |
Computed by PubChem (NCBI)