CAS 16723-50-5 is the registry number for 3-Methylthiochroman-4-one 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-one (CAS 16723-50-5) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 3-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-one. InChIKey: RYBZBWQHLZSAGB-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | 3-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| InChIKey | RYBZBWQHLZSAGB-UHFFFAOYSA-N |
| SMILES | CC1CS(=O)(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)