CAS 521972-99-6 appears in our catalog under these names: Protonstatin-1/ 99.77% (existing batch purity), (5Z)-5-((Furan-2-yl)methylidene)-2-sulfanylidene-1,3-thiazolidin-4-one, Protonstatin-1, Protonstatin-1, 98.47%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 0,1g.
(5Z)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 521972-99-6) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: (5Z)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: ISSUVJNRFWFRIV-XQRVVYSFSA-N.
| Molecular formula | C8H5NO2S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | (5Z)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | ISSUVJNRFWFRIV-XQRVVYSFSA-N |
| SMILES | C1=COC(=C1)/C=C\2/C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)