cas: 114722-60-0 — see every product listed under this CAS number, including other names
Pyrazolo[1,5-a]quinoxalin-4(5H)-one 95% (CAS 114722-60-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A318242-100mg |
| cas | 114722-60-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 426.00 Pln | |
| Ambeed | 250mg | 815.38 Pln | |
| Ambeed | 1g | 1961.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A318242 |
5H-pyrazolo[1,5-a]quinoxalin-4-one (CAS 114722-60-0) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 5H-pyrazolo[1,5-a]quinoxalin-4-one. InChIKey: BNKZAGNSCZCLIN-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 5H-pyrazolo[1,5-a]quinoxalin-4-one |
| InChIKey | BNKZAGNSCZCLIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C3=CC=NN23 |
Computed by PubChem (NCBI)