CAS 61553-71-7 appears in our catalog under these names: 2,9-Dihydro-2,4,9-triaza-fluoren-1-one, 95%, 3H-Pyrimido(5,4-b)indol-4(5H)-one, 95%, 3H–Pyrimido(5,4–b)indol–4(5H)–one, 3H-Pyrimido[5,4-b]indol-4(5H)-one, 3H-Pyrimido[5,4-b]indol-4(5H)-one, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
3,5-dihydropyrimido[5,4-b]indol-4-one (CAS 61553-71-7) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,5-dihydropyrimido[5,4-b]indol-4-one. InChIKey: SQKANMIJNAMTAQ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3,5-dihydropyrimido[5,4-b]indol-4-one |
| InChIKey | SQKANMIJNAMTAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)