CAS 1934916-89-8 is the registry number for 2H,3H,4H-Pyridazino[4,5-b]indol-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3,5-dihydropyridazino[4,5-b]indol-4-one (CAS 1934916-89-8) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,5-dihydropyridazino[4,5-b]indol-4-one. InChIKey: PPZLFMXDTOJEPB-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3,5-dihydropyridazino[4,5-b]indol-4-one |
| InChIKey | PPZLFMXDTOJEPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=O)NN=C3 |
Computed by PubChem (NCBI)