Products 1934916-89-8

CAS 1934916-89-8 is the registry number for 2H,3H,4H-Pyridazino[4,5-b]indol-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3,5-dihydropyridazino[4,5-b]indol-4-one (CAS 1934916-89-8) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,5-dihydropyridazino[4,5-b]indol-4-one. InChIKey: PPZLFMXDTOJEPB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O
Molecular weight185.18 g/mol
IUPAC name3,5-dihydropyridazino[4,5-b]indol-4-one
InChIKeyPPZLFMXDTOJEPB-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=C(N2)C(=O)NN=C3

Computed by PubChem (NCBI)