CAS 1087654-58-7 is the registry number for Pyrimido[1,2-a]benzimidazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
10H-pyrimido[1,2-a]benzimidazol-4-one (CAS 1087654-58-7) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 10H-pyrimido[1,2-a]benzimidazol-4-one. InChIKey: CGZQZQJXCXOPDW-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 10H-pyrimido[1,2-a]benzimidazol-4-one |
| InChIKey | CGZQZQJXCXOPDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=NC=CC(=O)N23 |
Computed by PubChem (NCBI)