CAS 1283108-89-3 is the registry number for 3-(3-Methyl-1,2,4-oxadiazol-5-yl)benzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
3-(3-methyl-1,2,4-oxadiazol-5-yl)benzonitrile (CAS 1283108-89-3) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3-(3-methyl-1,2,4-oxadiazol-5-yl)benzonitrile. InChIKey: GKPPRWGCTPEQTA-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)benzonitrile |
| InChIKey | GKPPRWGCTPEQTA-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)