CAS 65923-21-9 is the registry number for 1,5-Dihydro-6h-[1,2]diazepino[4,5,6-cd]indol-6-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-9-one (CAS 65923-21-9) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-9-one. InChIKey: XNFAEXRJJDIECW-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-9-one |
| InChIKey | XNFAEXRJJDIECW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC=C3C=NNC2=O |
Computed by PubChem (NCBI)