CAS 5719-50-6 appears in our catalog under these names: 3H-Pyrimido[4,5-b]indol-4(9h)-one, 95%, 3H-Pyrimido(4,5-b)indol-4(9H)-one, 95+%, 3,9-Dihydro-4H-pyrimido(4,5-b)indol-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 50mg, 0,5g.
3,9-dihydropyrimido[4,5-b]indol-4-one (CAS 5719-50-6) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,9-dihydropyrimido[4,5-b]indol-4-one. InChIKey: HGLOYSHAQVDDDZ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3,9-dihydropyrimido[4,5-b]indol-4-one |
| InChIKey | HGLOYSHAQVDDDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=CNC3=O |
Computed by PubChem (NCBI)