cas: 24811-78-7 — see every product listed under this CAS number, including other names
Pyrimido[1,2-a]benzimidazol-2(1H)-one, 95%, 95% (CAS 24811-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PIK-100mg |
| cas | 24811-78-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1302.80 Pln | |
| Chemat | 250mg | 2128.40 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1H-pyrimido[1,2-a]benzimidazol-2-one (CAS 24811-78-7) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 1H-pyrimido[1,2-a]benzimidazol-2-one. InChIKey: IZRYCLMZDYFCMJ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 1H-pyrimido[1,2-a]benzimidazol-2-one |
| InChIKey | IZRYCLMZDYFCMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C=CC(=O)N3 |
Computed by PubChem (NCBI)