cas: 745784-12-7 — see every product listed under this CAS number, including other names
Quinolin-2-ylboronic acid 98% (CAS 745784-12-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A155442-250mg |
| cas | 745784-12-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 820.94 Pln | |
| Ambeed | 1g | 1850.00 Pln | |
| Ambeed | 5g | 5454.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A155442 |
Quinolin-2-ylboronic acid (CAS 745784-12-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-2-ylboronic acid. InChIKey: DWHCQRBWSBKHMI-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-2-ylboronic acid |
| InChIKey | DWHCQRBWSBKHMI-UHFFFAOYSA-N |
| SMILES | B(C1=NC2=CC=CC=C2C=C1)(O)O |
Computed by PubChem (NCBI)