cas: 18004-62-1 — see every product listed under this CAS number, including other names
Quinolin-2-ylmethanamine dihydrochloride 97% (CAS 18004-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A650215-100mg |
| cas | 18004-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 837.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A650215 |
Quinolin-2-ylmethanamine;dihydrochloride (CAS 18004-62-1) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: quinolin-2-ylmethanamine;dihydrochloride. InChIKey: XPAZBFLKFMBGMF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | quinolin-2-ylmethanamine;dihydrochloride |
| InChIKey | XPAZBFLKFMBGMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)