cas: 376581-24-7 — see every product listed under this CAS number, including other names
Quinolin-6-ylboronic Acid (contains varying amounts of Anhydride) (CAS 376581-24-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | Q0098-1G |
| cas | 376581-24-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 187.19 Pln | |
| TCI | 5g | 585.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
Quinolin-6-ylboronic acid (CAS 376581-24-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-6-ylboronic acid. InChIKey: JLOLSBLXNMVKGY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-6-ylboronic acid |
| InChIKey | JLOLSBLXNMVKGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=CC=C2)(O)O |
Computed by PubChem (NCBI)