cas: 376581-24-7 — see every product listed under this CAS number, including other names
Quinoline-6-boronic acid, 97%, 97% (CAS 376581-24-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148JN-250mg |
| cas | 376581-24-7 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Quinolin-6-ylboronic acid (CAS 376581-24-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-6-ylboronic acid. InChIKey: JLOLSBLXNMVKGY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-6-ylboronic acid |
| InChIKey | JLOLSBLXNMVKGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=CC=C2)(O)O |
Computed by PubChem (NCBI)