cas: 35203-91-9 — see every product listed under this CAS number, including other names
Quinoline-8-sulfonamide, 95%, 95% (CAS 35203-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9GN-100mg |
| cas | 35203-91-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1624.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Quinoline-8-sulfonamide (CAS 35203-91-9) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: quinoline-8-sulfonamide. InChIKey: ZTYZEUXZHGOXRT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | quinoline-8-sulfonamide |
| InChIKey | ZTYZEUXZHGOXRT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)N)N=CC=C2 |
Computed by PubChem (NCBI)