Products 90850-44-5
CAS 90850-44-5 appears in our catalog under these names: 4-(2-Amino-1,3-thiazol-4-yl)benzene-1,3-diol, 95%, 4-(2-Amino-1,3-thiazol-4-yl)benzene-1,3-diol, 4-(2-Aminothiazol-4-yl)benzene-1,3-diol, 98%, 98%, 4-(2-Amino-1,3-thiazol-4-yl)benzene-1,3-, diol, 50 mg, 4-(2-Amino-1,3-thiazol-4-yl)benzene-1,3-, diol, 100 mg. Offered by: Combi-blocks, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 50mg, 500mg, 1000mg.
4-(2-amino-1,3-thiazol-4-yl)benzene-1,3-diol (CAS 90850-44-5) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 4-(2-amino-1,3-thiazol-4-yl)benzene-1,3-diol. InChIKey: JWBRZKPADMMQTN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 4-(2-amino-1,3-thiazol-4-yl)benzene-1,3-diol |
| InChIKey | JWBRZKPADMMQTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C2=CSC(=N2)N |
Computed by PubChem (NCBI)