CAS 1025010-00-7 appears in our catalog under these names: 3-(5-Methyl-2-thienyl)-1h-pyrazole-5-carboxylic acid, 95%, 5-(5-Methyl-thiophen-2-yl)-2H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 50g, 1g, 25g, 5g.
5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carboxylic acid (CAS 1025010-00-7) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carboxylic acid. InChIKey: JIJVBLCUMDFCFW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carboxylic acid |
| InChIKey | JIJVBLCUMDFCFW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=CC(=NN2)C(=O)O |
Computed by PubChem (NCBI)