Products 264210-49-3
CAS 264210-49-3 appears in our catalog under these names: SLK/STK10-IN-1, SLK/STK10–IN–1, SLK/STK10-IN-1, 99.78%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 100 mg, 10 mg, 50 mg.
3-(3-chloroanilino)-4-(2-methoxyphenyl)pyrrole-2,5-dione (CAS 264210-49-3) is a chemical compound with the molecular formula C17H13ClN2O3 and a molecular weight of 328.7 g/mol. IUPAC name: 3-(3-chloroanilino)-4-(2-methoxyphenyl)pyrrole-2,5-dione. InChIKey: DQYDZCRLDYVZKY-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O3 |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | 3-(3-chloroanilino)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| InChIKey | DQYDZCRLDYVZKY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=C(C(=O)NC2=O)NC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)