cas: 36411-52-6 — see every product listed under this CAS number, including other names
Salicyloylaminotriazole, >98.0%(HPLC)(T) (CAS 36411-52-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A3646-5G |
| cas | 36411-52-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 501.89 Pln | |
| TCI | 25g | 1706.62 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide (CAS 36411-52-6) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide. InChIKey: MZZYGYNZAOVRTG-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide |
| InChIKey | MZZYGYNZAOVRTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NC=NN2)O |
Computed by PubChem (NCBI)