Sodium 2,5-dimethylbenzenesulfonate, 98%
cas: 827-19-0 — see every product listed under this CAS number, including other names
Sodium 2,5-dimethylbenzenesulfonate, 98% (CAS 827-19-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1003843-1g |
| cas | 827-19-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 637.38 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 347.60 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 25g | 680.90 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 25g | 643.54 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 633.13 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Sodium 2,5-dimethylbenzenesulfonate (CAS 827-19-0) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium 2,5-dimethylbenzenesulfonate. InChIKey: SDCULNUHRZODAC-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium 2,5-dimethylbenzenesulfonate |
| InChIKey | SDCULNUHRZODAC-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
sodium 2,5-dimethylbenzenesulfonate, sodium p-xylenesulfonate, sodium 2,5-dimethylbenzene-1-sulfonate, Benzenesulfonic acid, 2,5-dimethyl-, sodium salt, Sodium p-xylene-2-sulfonate, sodium;2,5-dimethylbenzenesulfonate, 2,5-Dimethylbenzenesulfonic acid sodium salt monohydrate, Sodium p-xylene-2-sulphonate, sodium2,5-dimethylbenzenesulfonate, Natrium-p-xylol-2-sulfonat