CAS 827-93-0 is the registry number for sodium 3,4–dimethylbenzenesulfonate. Offered by: GLPBio. Available pack sizes: 10g, 1g, 2,5g, 250mg, 500mg, 5g.
Sodium 3,4-dimethylbenzenesulfonate (CAS 827-93-0) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium 3,4-dimethylbenzenesulfonate. InChIKey: QUCDWLYKDRVKMI-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium 3,4-dimethylbenzenesulfonate |
| InChIKey | QUCDWLYKDRVKMI-UHFFFAOYSA-M |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)