CAS 1226797-99-4 appears in our catalog under these names: Sodium (3-methylphenyl)methanesulfonate, 95%, Sodium (3–Methylphenyl)Methanesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Sodium (3-methylphenyl)methanesulfonate (CAS 1226797-99-4) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium (3-methylphenyl)methanesulfonate. InChIKey: AQAMPWVXFRSBIP-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium (3-methylphenyl)methanesulfonate |
| InChIKey | AQAMPWVXFRSBIP-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC=C1)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)