CAS 1300-72-7 appears in our catalog under these names: Sodium xylenesulfonate, 95%, Sodium xylenesulfonate, 98%, Xylenesulfonic Acid Sodium Salt, >95% (HPLC), Sodium xylenesulfonate, XYLENESULFONIC ACID SODIUM SALT, &. Offered by: Combi-blocks, AmBeed, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 10g, 10kg, 5kg, 25kg, 1KG.
Sodium 3,4-dimethylbenzenesulfonate (CAS 1300-72-7) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium 3,4-dimethylbenzenesulfonate. InChIKey: QUCDWLYKDRVKMI-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium 3,4-dimethylbenzenesulfonate |
| InChIKey | QUCDWLYKDRVKMI-UHFFFAOYSA-M |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)