CAS 1865090-46-5 is the registry number for Sodium 3-ethoxybenzene-1-sulfinate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Sodium 3-ethoxybenzenesulfinate (CAS 1865090-46-5) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium 3-ethoxybenzenesulfinate. InChIKey: WAWGBRYODXOFRT-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium 3-ethoxybenzenesulfinate |
| InChIKey | WAWGBRYODXOFRT-UHFFFAOYSA-M |
| SMILES | CCOC1=CC(=CC=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)