CAS 82635-16-3 is the registry number for Sodium 2-methoxy-5-methylbenzene-1-sulfinate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2-methoxy-5-methylbenzenesulfinate (CAS 82635-16-3) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium 2-methoxy-5-methylbenzenesulfinate. InChIKey: BNFYODUUNLSIOA-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium 2-methoxy-5-methylbenzenesulfinate |
| InChIKey | BNFYODUUNLSIOA-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1)OC)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)