CAS 14995-38-1 appears in our catalog under these names: 4-Ethylbenzenesulfonic acid sodium salt, 98%, 4–Ethylbenzenesulfonic acid sodium salt, Sodium 4-Ethylbenzenesulfonate, >98.0%(HPLC)(T), 4-Ethylbenzenesulfonic acid sodium salt, 95%, 95%, Sodium 4-Ethylbenzenesulfonate, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
Sodium 4-ethylbenzenesulfonate (CAS 14995-38-1) is a chemical compound with the molecular formula C8H9NaO3S and a molecular weight of 208.21 g/mol. IUPAC name: sodium 4-ethylbenzenesulfonate. InChIKey: LLELGQVCQVOGMA-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO3S |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | sodium 4-ethylbenzenesulfonate |
| InChIKey | LLELGQVCQVOGMA-UHFFFAOYSA-M |
| SMILES | CCC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)