cas: 3715-31-9 — see every product listed under this CAS number, including other names
Sodium 3-methyl-2-oxopentanoate, 98%, 98% (CAS 3715-31-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JPC-1g |
| cas | 3715-31-9 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 669.20 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 500mg | 443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium 3-methyl-2-oxopentanoate (CAS 3715-31-9) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 152.12 g/mol. IUPAC name: sodium 3-methyl-2-oxopentanoate. InChIKey: SMDJDLCNOXJGKC-UHFFFAOYSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | sodium 3-methyl-2-oxopentanoate |
| InChIKey | SMDJDLCNOXJGKC-UHFFFAOYSA-M |
| SMILES | CCC(C)C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)