Products 1795020-84-6
CAS 1795020-84-6 appears in our catalog under these names: 4-Methyl-2-oxovaleric Acid-d7 Sodium Salt, >95% (HPLC), 4-Methyl-2-oxopentanoic acid-d7 (sodium). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
Sodium 4,5,5,5-tetradeuterio-2-oxo-4-(trideuteriomethyl)pentanoate (CAS 1795020-84-6) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 159.17 g/mol. IUPAC name: sodium 4,5,5,5-tetradeuterio-2-oxo-4-(trideuteriomethyl)pentanoate. InChIKey: IXFAZKRLPPMQEO-PWPMZRLPSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 159.17 g/mol |
| IUPAC name | sodium 4,5,5,5-tetradeuterio-2-oxo-4-(trideuteriomethyl)pentanoate |
| InChIKey | IXFAZKRLPPMQEO-PWPMZRLPSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])(CC(=O)C(=O)[O-])C([2H])([2H])[2H].[Na+] |
Computed by PubChem (NCBI)