CAS 2988556-44-9 is the registry number for Sodium 4-methyl-3-oxopentanoate 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Sodium 4-methyl-3-oxopentanoate (CAS 2988556-44-9) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 152.12 g/mol. IUPAC name: sodium 4-methyl-3-oxopentanoate. InChIKey: NNZIKJVBDRXAMZ-UHFFFAOYSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | sodium 4-methyl-3-oxopentanoate |
| InChIKey | NNZIKJVBDRXAMZ-UHFFFAOYSA-M |
| SMILES | CC(C)C(=O)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)