CAS 1795037-03-4 appears in our catalog under these names: 2-Oxo-3-methylpentanoic Acid-d8 Sodium Salt, 3-Methyl-2-oxovaleric Acid-d8 Sodium Salt, >95% (HPLC), 3–Methyl–2–oxovaleric acid–d8 sodium, 3-Methyl-2-oxovaleric acid-d8 (sodium), 99.74%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 500μg, 1mg, 500 μg, 5 mg, 1 mg.
Sodium 4,4,5,5,5-pentadeuterio-2-oxo-3-(trideuteriomethyl)pentanoate (CAS 1795037-03-4) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 160.17 g/mol. IUPAC name: sodium 4,4,5,5,5-pentadeuterio-2-oxo-3-(trideuteriomethyl)pentanoate. InChIKey: SMDJDLCNOXJGKC-FIRJCWQZSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | sodium 4,4,5,5,5-pentadeuterio-2-oxo-3-(trideuteriomethyl)pentanoate |
| InChIKey | SMDJDLCNOXJGKC-FIRJCWQZSA-M |
| SMILES | [2H]C([2H])([2H])C(C(=O)C(=O)[O-])C([2H])([2H])C([2H])([2H])[2H].[Na+] |
Computed by PubChem (NCBI)