CAS 93523-70-7 appears in our catalog under these names: 4–Methyl–2–oxopentanoic acid–13C sodium, 4-METHYL-2-OXOPENTANOIC-1-13C ACID, SOD&, 4-Methyl-2-oxopentanoic acid-13C (sodium), ≥99 atom% 13C,≥98%, ≥99 atom% 13C,≥98%, 4-Methyl-2-oxopentanoic acid-13C (sodium), 98.0%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 250MG, 10 mg, 50 mg.
Sodium 4-methyl-2-oxo(113C)pentanoate (CAS 93523-70-7) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 153.12 g/mol. IUPAC name: sodium 4-methyl-2-oxo(113C)pentanoate. InChIKey: IXFAZKRLPPMQEO-NWZHYJCUSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 153.12 g/mol |
| IUPAC name | sodium 4-methyl-2-oxo(113C)pentanoate |
| InChIKey | IXFAZKRLPPMQEO-NWZHYJCUSA-M |
| SMILES | CC(C)CC(=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)