CAS 1391052-48-4 is the registry number for 3-Methyl-2-oxovaleric Acid-13C3 Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium 3-methyl-2-oxo(1,2,3-13C3)pentanoate (CAS 1391052-48-4) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 155.10 g/mol. IUPAC name: sodium 3-methyl-2-oxo(1,2,3-13C3)pentanoate. InChIKey: SMDJDLCNOXJGKC-IIDVSRKWSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 155.10 g/mol |
| IUPAC name | sodium 3-methyl-2-oxo(1,2,3-13C3)pentanoate |
| InChIKey | SMDJDLCNOXJGKC-IIDVSRKWSA-M |
| SMILES | CC[13CH](C)[13C](=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)