Sodium 4-methyl-3-oxopentanoate, 95%
cas: 2988556-44-9 — see every product listed under this CAS number, including other names
Sodium 4-methyl-3-oxopentanoate, 95% (CAS 2988556-44-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A12964003-25mg |
| cas | 2988556-44-9 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 487.19 Pln | |
| Ambeed | 50mg | 776.44 Pln | |
| Ambeed | 100mg | 1271.50 Pln | |
| Ambeed | 250mg | 2228.25 Pln | |
| Ambeed | 1g | 5882.81 Pln | |
| BLDpharm | 25mg | 519.84 Pln | |
| BLDpharm | 50mg | 836.40 Pln | |
| BLDpharm | 100mg | 1363.99 Pln | |
| BLDpharm | 250mg | 2396.96 Pln | |
| BLDpharm | 1g | 6340.01 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Sodium 4-methyl-3-oxopentanoate (CAS 2988556-44-9) is a chemical compound with the molecular formula C6H9NaO3 and a molecular weight of 152.12 g/mol. IUPAC name: sodium 4-methyl-3-oxopentanoate. InChIKey: NNZIKJVBDRXAMZ-UHFFFAOYSA-M.
| Molecular formula | C6H9NaO3 |
|---|---|
| Molecular weight | 152.12 g/mol |
| IUPAC name | sodium 4-methyl-3-oxopentanoate |
| InChIKey | NNZIKJVBDRXAMZ-UHFFFAOYSA-M |
| SMILES | CC(C)C(=O)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)