CAS 120-05-8 appears in our catalog under these names: Sulfuretin, Sulfuretin/ 98.91% (existing batch purity), Sulfuretin 98%, Sulfuretin, 98%, 98%, Sulfuretin, 99.36%. Offered by: TRC, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 250mg, 10 mg.
(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (CAS 120-05-8) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one. InChIKey: RGNXWPVNPFAADO-NSIKDUERSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| InChIKey | RGNXWPVNPFAADO-NSIKDUERSA-N |
| SMILES | C1=CC(=C(C=C1/C=C\2/C(=O)C3=C(O2)C=C(C=C3)O)O)O |
Computed by PubChem (NCBI)