CAS 70351-51-8 appears in our catalog under these names: Supercinnamaldehyde/ 98.89% (existing batch purity), Supercinnamaldehyde, Supercinnamaldehyde 99%, Supercinnamaldehyde, 98.89% ,, 98.89% ,, Supercinnamaldehyde, 99.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200mg.
(3Z)-1-methyl-3-(2-oxopropylidene)indol-2-one (CAS 70351-51-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: (3Z)-1-methyl-3-(2-oxopropylidene)indol-2-one. InChIKey: CZKBLHCEDVWPRN-YFHOEESVSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (3Z)-1-methyl-3-(2-oxopropylidene)indol-2-one |
| InChIKey | CZKBLHCEDVWPRN-YFHOEESVSA-N |
| SMILES | CC(=O)/C=C\1/C2=CC=CC=C2N(C1=O)C |
Computed by PubChem (NCBI)