cas: 105935-24-8 — see every product listed under this CAS number, including other names
T-butyl2-(trifluoromethyl)acrylate 97% (CAS 105935-24-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A832073-250mg |
| cas | 105935-24-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1488.44 Pln | |
| Ambeed | 10g | 2295.00 Pln | |
| Ambeed | 25g | 4419.88 Pln | |
| Ambeed | 100g | 13125.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A832073 |
Tert-butyl 2-(trifluoromethyl)prop-2-enoate (CAS 105935-24-8) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: tert-butyl 2-(trifluoromethyl)prop-2-enoate. InChIKey: RCSSZBOUAGQERK-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | tert-butyl 2-(trifluoromethyl)prop-2-enoate |
| InChIKey | RCSSZBOUAGQERK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=C)C(F)(F)F |
Computed by PubChem (NCBI)