cas: 105935-24-8 — see every product listed under this CAS number, including other names
tert-Butyl 2-(trifluoromethyl)acrylate (CAS 105935-24-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635863-250MG |
| cas | 105935-24-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 10g | 1752.53 Pln | |
| Fluorochem | 25g | 3236.38 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2-(trifluoromethyl)prop-2-enoate (CAS 105935-24-8) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: tert-butyl 2-(trifluoromethyl)prop-2-enoate. InChIKey: RCSSZBOUAGQERK-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | tert-butyl 2-(trifluoromethyl)prop-2-enoate |
| InChIKey | RCSSZBOUAGQERK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=C)C(F)(F)F |
Computed by PubChem (NCBI)