CAS 100823-03-8 appears in our catalog under these names: TC11, TC11/ 98.1% (existing batch purity), 2-(2,6-Diisopropylphenyl)-5-amino-1H-isoindole-1,3-dione, TC11 97%, 5-Amino-2-(2,6-diisopropylphenyl)isoindoline-1,3-dione, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 200mg, 250mg, 1g.
5-amino-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione (CAS 100823-03-8) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: 5-amino-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione. InChIKey: NRPIRIUWEKTNGQ-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 5-amino-2-[2,6-di(propan-2-yl)phenyl]isoindole-1,3-dione |
| InChIKey | NRPIRIUWEKTNGQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N2C(=O)C3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)