cas: 1191901-33-3 — see every product listed under this CAS number, including other names
TCO-NHS ester 95% rel-(1R-4E-pR)-equatorial (CAS 1191901-33-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A545750-10mg |
| cas | 1191901-33-3 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 498.31 Pln | |
| Ambeed | 25mg | 832.06 Pln | |
| Ambeed | 50mg | 1354.94 Pln | |
| Ambeed | 100mg | 2261.62 Pln | |
| Ambeed | 250mg | 3785.75 Pln | |
| Ambeed | 1g | 9153.56 Pln | |
| Ambeed | 5g | 22236.56 Pln |
| purity | 95% rel-(1R-4E-pR)-equatorial |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A545750 |
[(4E)-cyclooct-4-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1191901-33-3) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: [(4E)-cyclooct-4-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: OUGQJOKGFAIFAQ-OWOJBTEDSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | [(4E)-cyclooct-4-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | OUGQJOKGFAIFAQ-OWOJBTEDSA-N |
| SMILES | C1C/C=C/CCC(C1)OC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)